C23H22IN3O6 — CID 126266811
N-(2,3-dimethylphenyl)-2-[2-ethoxy-6-iodo-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide (PubChem CID 126266811) has the molecular formula C23H22IN3O6 and a molecular weight of 563.35 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[2-ethoxy-6-iodo-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[2-ethoxy-6-iodo-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126266811 |
| Molecular Formula | C23H22IN3O6 |
| Molecular Weight | 563.35 g/mol |
| Exact Mass | 563.06 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[2-ethoxy-6-iodo-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide |
| SMILES | CCOc1cc(C=C2C(=O)NC(=O)NC2=O)cc(I)c1OCC(=O)Nc1cccc(C)c1C |
| InChI | InChI=1S/C23H22IN3O6/c1-4-32-18-10-14(8-15-21(29)26-23(31)27-22(15)30)9-16(24)20(18)33-11-19(28)25-17-7-5-6-12(2)13(17)3/h5-10H,4,11H2,1-3H3,(H,25,28)(H2,26,27,29,30,31) |
| InChIKey | TWXUVNYRDHTJLZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|