C22H19ClIN3O5S — CID 126272692
N-(3-chloro-4-methylphenyl)-2-[4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-ethoxy-6-iodophenoxy]acetamide (PubChem CID 126272692) has the molecular formula C22H19ClIN3O5S and a molecular weight of 599.83 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-[4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-ethoxy-6-iodophenoxy]acetamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-[4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-ethoxy-6-iodophenoxy]acetamide |
|---|---|
| PubChem CID | 126272692 |
| Molecular Formula | C22H19ClIN3O5S |
| Molecular Weight | 599.83 g/mol |
| Exact Mass | 598.98 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-[4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-ethoxy-6-iodophenoxy]acetamide |
| SMILES | CCOc1cc(C=C2C(=O)NC(=S)NC2=O)cc(I)c1OCC(=O)Nc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C22H19ClIN3O5S/c1-3-31-17-8-12(6-14-20(29)26-22(33)27-21(14)30)7-16(24)19(17)32-10-18(28)25-13-5-4-11(2)15(23)9-13/h4-9H,3,10H2,1-2H3,(H,25,28)(H2,26,27,29,30,33) |
| InChIKey | ZJWUJXVWMKLOLX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.83 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|