C15H13IN2O6S — CID 1292033
2-[4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-ethoxy-6-iodophenoxy]acetic acid (PubChem CID 1292033) has the molecular formula C15H13IN2O6S and a molecular weight of 476.25 g/mol. Its IUPAC name is 2-[4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-ethoxy-6-iodophenoxy]acetic acid.
| Compound Name | 2-[4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-ethoxy-6-iodophenoxy]acetic acid |
|---|---|
| PubChem CID | 1292033 |
| Molecular Formula | C15H13IN2O6S |
| Molecular Weight | 476.25 g/mol |
| Exact Mass | 475.95 |
| IUPAC Name | 2-[4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-2-ethoxy-6-iodophenoxy]acetic acid |
| SMILES | CCOc1cc(C=C2C(=O)NC(=S)NC2=O)cc(I)c1OCC(=O)O |
| InChI | InChI=1S/C15H13IN2O6S/c1-2-23-10-5-7(4-9(16)12(10)24-6-11(19)20)3-8-13(21)17-15(25)18-14(8)22/h3-5H,2,6H2,1H3,(H,19,20)(H2,17,18,21,22,25) |
| InChIKey | KTBPVBCRSZTNRV-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|