C18H13IN2O7 — CID 1295957
[2-ethoxy-6-iodo-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenyl] furan-2-carboxylate (PubChem CID 1295957) has the molecular formula C18H13IN2O7 and a molecular weight of 496.21 g/mol. Its IUPAC name is [2-ethoxy-6-iodo-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenyl] furan-2-carboxylate.
| Compound Name | [2-ethoxy-6-iodo-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 1295957 |
| Molecular Formula | C18H13IN2O7 |
| Molecular Weight | 496.21 g/mol |
| Exact Mass | 495.98 |
| IUPAC Name | [2-ethoxy-6-iodo-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenyl] furan-2-carboxylate |
| SMILES | CCOc1cc(C=C2C(=O)NC(=O)NC2=O)cc(I)c1OC(=O)c1ccco1 |
| InChI | InChI=1S/C18H13IN2O7/c1-2-26-13-8-9(6-10-15(22)20-18(25)21-16(10)23)7-11(19)14(13)28-17(24)12-4-3-5-27-12/h3-8H,2H2,1H3,(H2,20,21,22,23,25) |
| InChIKey | FDGZBRULGVFFMH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.21 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|