C21H18BrN3O5S — CID 126050648
2-[2-bromo-4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-6-ethoxyphenoxy]-N-phenylacetamide (PubChem CID 126050648) has the molecular formula C21H18BrN3O5S and a molecular weight of 504.36 g/mol. Its IUPAC name is 2-[2-bromo-4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-6-ethoxyphenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-bromo-4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-6-ethoxyphenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126050648 |
| Molecular Formula | C21H18BrN3O5S |
| Molecular Weight | 504.36 g/mol |
| Exact Mass | 503.02 |
| IUPAC Name | 2-[2-bromo-4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-6-ethoxyphenoxy]-N-phenylacetamide |
| SMILES | CCOc1cc(C=C2C(=O)NC(=S)NC2=O)cc(Br)c1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H18BrN3O5S/c1-2-29-16-10-12(8-14-19(27)24-21(31)25-20(14)28)9-15(22)18(16)30-11-17(26)23-13-6-4-3-5-7-13/h3-10H,2,11H2,1H3,(H,23,26)(H2,24,25,27,28,31) |
| InChIKey | UOFXFJYOCQACJS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|