C21H17Cl2N3O4S — CID 126279089
2-[2,6-dichloro-4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(3,4-dimethylphenyl)acetamide (PubChem CID 126279089) has the molecular formula C21H17Cl2N3O4S and a molecular weight of 478.36 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(3,4-dimethylphenyl)acetamide.
| Compound Name | 2-[2,6-dichloro-4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126279089 |
| Molecular Formula | C21H17Cl2N3O4S |
| Molecular Weight | 478.36 g/mol |
| Exact Mass | 477.03 |
| IUPAC Name | 2-[2,6-dichloro-4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(3,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2c(Cl)cc(C=C3C(=O)NC(=S)NC3=O)cc2Cl)cc1C |
| InChI | InChI=1S/C21H17Cl2N3O4S/c1-10-3-4-13(5-11(10)2)24-17(27)9-30-18-15(22)7-12(8-16(18)23)6-14-19(28)25-21(31)26-20(14)29/h3-8H,9H2,1-2H3,(H,24,27)(H2,25,26,28,29,31) |
| InChIKey | UJQQEDOSRSMKDQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|