C28H22Cl2IN3O6 — CID 126276335
2-[4-[(Z)-[1-(3,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]-N-(2,3-dimethylphenyl)acetamide (PubChem CID 126276335) has the molecular formula C28H22Cl2IN3O6 and a molecular weight of 694.31 g/mol. Its IUPAC name is 2-[4-[(Z)-[1-(3,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-[4-[(Z)-[1-(3,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126276335 |
| Molecular Formula | C28H22Cl2IN3O6 |
| Molecular Weight | 694.31 g/mol |
| Exact Mass | 692.99 |
| IUPAC Name | 2-[4-[(Z)-[1-(3,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]-N-(2,3-dimethylphenyl)acetamide |
| SMILES | COc1cc(/C=C2/C(=O)NC(=O)N(c3ccc(Cl)c(Cl)c3)C2=O)cc(I)c1OCC(=O)Nc1cccc(C)c1C |
| InChI | InChI=1S/C28H22Cl2IN3O6/c1-14-5-4-6-22(15(14)2)32-24(35)13-40-25-21(31)10-16(11-23(25)39-3)9-18-26(36)33-28(38)34(27(18)37)17-7-8-19(29)20(30)12-17/h4-12H,13H2,1-3H3,(H,32,35)(H,33,36,38)/b18-9- |
| InChIKey | CSODIYJZKWVWOV-NVMNQCDNSA-N |
| XLogP | 5.91 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.31 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|