C27H20Cl2IN3O6 — CID 126276162
N-(2-chlorophenyl)-2-[4-[(E)-[1-(3-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-ethoxy-6-iodophenoxy]acetamide (PubChem CID 126276162) has the molecular formula C27H20Cl2IN3O6 and a molecular weight of 680.28 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[4-[(E)-[1-(3-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-ethoxy-6-iodophenoxy]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[4-[(E)-[1-(3-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-ethoxy-6-iodophenoxy]acetamide |
|---|---|
| PubChem CID | 126276162 |
| Molecular Formula | C27H20Cl2IN3O6 |
| Molecular Weight | 680.28 g/mol |
| Exact Mass | 678.98 |
| IUPAC Name | N-(2-chlorophenyl)-2-[4-[(E)-[1-(3-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-ethoxy-6-iodophenoxy]acetamide |
| SMILES | CCOc1cc(/C=C2\C(=O)NC(=O)N(c3cccc(Cl)c3)C2=O)cc(I)c1OCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C27H20Cl2IN3O6/c1-2-38-22-12-15(11-20(30)24(22)39-14-23(34)31-21-9-4-3-8-19(21)29)10-18-25(35)32-27(37)33(26(18)36)17-7-5-6-16(28)13-17/h3-13H,2,14H2,1H3,(H,31,34)(H,32,35,37)/b18-10+ |
| InChIKey | NICRFXGHXPLEFG-VCHYOVAHSA-N |
| XLogP | 5.68 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.28 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|