C27H20Cl2FN3O6 — CID 126268768
2-[2-chloro-6-ethoxy-4-[(E)-[1-(4-fluorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-chlorophenyl)acetamide (PubChem CID 126268768) has the molecular formula C27H20Cl2FN3O6 and a molecular weight of 572.38 g/mol. Its IUPAC name is 2-[2-chloro-6-ethoxy-4-[(E)-[1-(4-fluorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-[2-chloro-6-ethoxy-4-[(E)-[1-(4-fluorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 126268768 |
| Molecular Formula | C27H20Cl2FN3O6 |
| Molecular Weight | 572.38 g/mol |
| Exact Mass | 571.07 |
| IUPAC Name | 2-[2-chloro-6-ethoxy-4-[(E)-[1-(4-fluorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-chlorophenyl)acetamide |
| SMILES | CCOc1cc(/C=C2\C(=O)NC(=O)N(c3ccc(F)cc3)C2=O)cc(Cl)c1OCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C27H20Cl2FN3O6/c1-2-38-22-13-15(12-20(29)24(22)39-14-23(34)31-21-6-4-3-5-19(21)28)11-18-25(35)32-27(37)33(26(18)36)17-9-7-16(30)8-10-17/h3-13H,2,14H2,1H3,(H,31,34)(H,32,35,37)/b18-11+ |
| InChIKey | ICKHFKCWAFODIQ-WOJGMQOQSA-N |
| XLogP | 5.22 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.38 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|