C17H11ClN2O6S — CID 126078277
[2-chloro-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenyl] benzenesulfonate (PubChem CID 126078277) has the molecular formula C17H11ClN2O6S and a molecular weight of 406.80 g/mol. Its IUPAC name is [2-chloro-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenyl] benzenesulfonate.
| Compound Name | [2-chloro-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126078277 |
| Molecular Formula | C17H11ClN2O6S |
| Molecular Weight | 406.80 g/mol |
| Exact Mass | 406.00 |
| IUPAC Name | [2-chloro-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenyl] benzenesulfonate |
| SMILES | O=C1NC(=O)C(=Cc2ccc(OS(=O)(=O)c3ccccc3)c(Cl)c2)C(=O)N1 |
| InChI | InChI=1S/C17H11ClN2O6S/c18-13-9-10(8-12-15(21)19-17(23)20-16(12)22)6-7-14(13)26-27(24,25)11-4-2-1-3-5-11/h1-9H,(H2,19,20,21,22,23) |
| InChIKey | QLWWPQDPWUDNIB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.80 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|