C17H9Cl3N2O6S — CID 126076865
[2,6-dichloro-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 126076865) has the molecular formula C17H9Cl3N2O6S and a molecular weight of 475.69 g/mol. Its IUPAC name is [2,6-dichloro-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2,6-dichloro-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126076865 |
| Molecular Formula | C17H9Cl3N2O6S |
| Molecular Weight | 475.69 g/mol |
| Exact Mass | 473.92 |
| IUPAC Name | [2,6-dichloro-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | O=C1NC(=O)C(=Cc2cc(Cl)c(OS(=O)(=O)c3ccc(Cl)cc3)c(Cl)c2)C(=O)N1 |
| InChI | InChI=1S/C17H9Cl3N2O6S/c18-9-1-3-10(4-2-9)29(26,27)28-14-12(19)6-8(7-13(14)20)5-11-15(23)21-17(25)22-16(11)24/h1-7H,(H2,21,22,23,24,25) |
| InChIKey | YLTFWDUDNLDAMS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.69 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|