C14H9Cl3O3S — CID 22886382
(2,4,6-trichlorophenyl) 4-ethenylbenzenesulfonate (PubChem CID 22886382) has the molecular formula C14H9Cl3O3S and a molecular weight of 363.65 g/mol. Its IUPAC name is (2,4,6-trichlorophenyl) 4-ethenylbenzenesulfonate.
| Compound Name | (2,4,6-trichlorophenyl) 4-ethenylbenzenesulfonate |
|---|---|
| PubChem CID | 22886382 |
| Molecular Formula | C14H9Cl3O3S |
| Molecular Weight | 363.65 g/mol |
| Exact Mass | 361.93 |
| IUPAC Name | (2,4,6-trichlorophenyl) 4-ethenylbenzenesulfonate |
| SMILES | C=Cc1ccc(S(=O)(=O)Oc2c(Cl)cc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C14H9Cl3O3S/c1-2-9-3-5-11(6-4-9)21(18,19)20-14-12(16)7-10(15)8-13(14)17/h2-8H,1H2 |
| InChIKey | OJPYOMCZMPCJQK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.65 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|