C19H13Cl2NO3S — CID 126219487
[2,6-dichloro-4-(phenyliminomethyl)phenyl] benzenesulfonate (PubChem CID 126219487) has the molecular formula C19H13Cl2NO3S and a molecular weight of 406.29 g/mol. Its IUPAC name is [2,6-dichloro-4-(phenyliminomethyl)phenyl] benzenesulfonate.
| Compound Name | [2,6-dichloro-4-(phenyliminomethyl)phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126219487 |
| Molecular Formula | C19H13Cl2NO3S |
| Molecular Weight | 406.29 g/mol |
| Exact Mass | 405.00 |
| IUPAC Name | [2,6-dichloro-4-(phenyliminomethyl)phenyl] benzenesulfonate |
| SMILES | O=S(=O)(Oc1c(Cl)cc(/C=N/c2ccccc2)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C19H13Cl2NO3S/c20-17-11-14(13-22-15-7-3-1-4-8-15)12-18(21)19(17)25-26(23,24)16-9-5-2-6-10-16/h1-13H/b22-13+ |
| InChIKey | TZJJWJBKCXSPSH-LPYMAVHISA-N |
| XLogP | 5.51 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.29 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|