C19H12Cl2N2O5S — CID 126072907
[2,6-dichloro-4-[(4-nitrophenyl)iminomethyl]phenyl] benzenesulfonate (PubChem CID 126072907) has the molecular formula C19H12Cl2N2O5S and a molecular weight of 451.29 g/mol. Its IUPAC name is [2,6-dichloro-4-[(4-nitrophenyl)iminomethyl]phenyl] benzenesulfonate.
| Compound Name | [2,6-dichloro-4-[(4-nitrophenyl)iminomethyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126072907 |
| Molecular Formula | C19H12Cl2N2O5S |
| Molecular Weight | 451.29 g/mol |
| Exact Mass | 449.98 |
| IUPAC Name | [2,6-dichloro-4-[(4-nitrophenyl)iminomethyl]phenyl] benzenesulfonate |
| SMILES | O=[N+]([O-])c1ccc(/N=C/c2cc(Cl)c(OS(=O)(=O)c3ccccc3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H12Cl2N2O5S/c20-17-10-13(12-22-14-6-8-15(9-7-14)23(24)25)11-18(21)19(17)28-29(26,27)16-4-2-1-3-5-16/h1-12H/b22-12+ |
| InChIKey | NIRVCTGDECFBLR-WSDLNYQXSA-N |
| XLogP | 5.42 |
| TPSA | 98.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.29 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|