C21H18N2O5S — CID 3329944
[4-[(3,4-dimethylphenyl)iminomethyl]phenyl] 4-nitrobenzenesulfonate (PubChem CID 3329944) has the molecular formula C21H18N2O5S and a molecular weight of 410.45 g/mol. Its IUPAC name is [4-[(3,4-dimethylphenyl)iminomethyl]phenyl] 4-nitrobenzenesulfonate.
| Compound Name | [4-[(3,4-dimethylphenyl)iminomethyl]phenyl] 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 3329944 |
| Molecular Formula | C21H18N2O5S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | [4-[(3,4-dimethylphenyl)iminomethyl]phenyl] 4-nitrobenzenesulfonate |
| SMILES | Cc1ccc(/N=C/c2ccc(OS(=O)(=O)c3ccc([N+](=O)[O-])cc3)cc2)cc1C |
| InChI | InChI=1S/C21H18N2O5S/c1-15-3-6-18(13-16(15)2)22-14-17-4-9-20(10-5-17)28-29(26,27)21-11-7-19(8-12-21)23(24)25/h3-14H,1-2H3/b22-14+ |
| InChIKey | WNCMLZHCUDEGEZ-HYARGMPZSA-N |
| XLogP | 4.73 |
| TPSA | 98.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|