C19H21N3O4S — CID 5172630
N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-1-(4-nitrophenyl)methanimine (PubChem CID 5172630) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-1-(4-nitrophenyl)methanimine.
| Compound Name | N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-1-(4-nitrophenyl)methanimine |
|---|---|
| PubChem CID | 5172630 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-1-(4-nitrophenyl)methanimine |
| SMILES | Cc1ccc(/N=C/c2ccc([N+](=O)[O-])cc2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C19H21N3O4S/c1-15-5-8-17(20-14-16-6-9-18(10-7-16)22(23)24)13-19(15)27(25,26)21-11-3-2-4-12-21/h5-10,13-14H,2-4,11-12H2,1H3/b20-14+ |
| InChIKey | XCUXBKKFFIWSFM-XSFVSMFZSA-N |
| XLogP | 3.83 |
| TPSA | 92.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|