C18H12Br2N4O5S — CID 3645506
[2,6-dibromo-4-[[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]phenyl] benzenesulfonate (PubChem CID 3645506) has the molecular formula C18H12Br2N4O5S and a molecular weight of 556.19 g/mol. Its IUPAC name is [2,6-dibromo-4-[[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]phenyl] benzenesulfonate.
| Compound Name | [2,6-dibromo-4-[[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 3645506 |
| Molecular Formula | C18H12Br2N4O5S |
| Molecular Weight | 556.19 g/mol |
| Exact Mass | 553.89 |
| IUPAC Name | [2,6-dibromo-4-[[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]phenyl] benzenesulfonate |
| SMILES | O=[N+]([O-])c1ccc(NN=Cc2cc(Br)c(OS(=O)(=O)c3ccccc3)c(Br)c2)nc1 |
| InChI | InChI=1S/C18H12Br2N4O5S/c19-15-8-12(10-22-23-17-7-6-13(11-21-17)24(25)26)9-16(20)18(15)29-30(27,28)14-4-2-1-3-5-14/h1-11H,(H,21,23) |
| InChIKey | QQHVYOUZWNFPRI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 123.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.19 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|