C19H12Br2ClNO3S — CID 126218700
[2,4-dibromo-6-(phenyliminomethyl)phenyl] 4-chlorobenzenesulfonate (PubChem CID 126218700) has the molecular formula C19H12Br2ClNO3S and a molecular weight of 529.64 g/mol. Its IUPAC name is [2,4-dibromo-6-(phenyliminomethyl)phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2,4-dibromo-6-(phenyliminomethyl)phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126218700 |
| Molecular Formula | C19H12Br2ClNO3S |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 526.86 |
| IUPAC Name | [2,4-dibromo-6-(phenyliminomethyl)phenyl] 4-chlorobenzenesulfonate |
| SMILES | O=S(=O)(Oc1c(Br)cc(Br)cc1/C=N/c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H12Br2ClNO3S/c20-14-10-13(12-23-16-4-2-1-3-5-16)19(18(21)11-14)26-27(24,25)17-8-6-15(22)7-9-17/h1-12H/b23-12+ |
| InChIKey | MSQXZBOKNYCFHZ-FSJBWODESA-N |
| XLogP | 6.38 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|