C20H15Br2NO4S — CID 126223634
[2,4-dibromo-6-[(4-methoxyphenyl)iminomethyl]phenyl] benzenesulfonate (PubChem CID 126223634) has the molecular formula C20H15Br2NO4S and a molecular weight of 525.22 g/mol. Its IUPAC name is [2,4-dibromo-6-[(4-methoxyphenyl)iminomethyl]phenyl] benzenesulfonate.
| Compound Name | [2,4-dibromo-6-[(4-methoxyphenyl)iminomethyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126223634 |
| Molecular Formula | C20H15Br2NO4S |
| Molecular Weight | 525.22 g/mol |
| Exact Mass | 522.91 |
| IUPAC Name | [2,4-dibromo-6-[(4-methoxyphenyl)iminomethyl]phenyl] benzenesulfonate |
| SMILES | COc1ccc(/N=C/c2cc(Br)cc(Br)c2OS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H15Br2NO4S/c1-26-17-9-7-16(8-10-17)23-13-14-11-15(21)12-19(22)20(14)27-28(24,25)18-5-3-2-4-6-18/h2-13H,1H3/b23-13+ |
| InChIKey | UUVHQTDARRHJTF-YDZHTSKRSA-N |
| XLogP | 5.74 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.22 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|