C21H18BrNO4S — CID 126219818
[4-bromo-2-[(4-methoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 126219818) has the molecular formula C21H18BrNO4S and a molecular weight of 460.35 g/mol. Its IUPAC name is [4-bromo-2-[(4-methoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-bromo-2-[(4-methoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126219818 |
| Molecular Formula | C21H18BrNO4S |
| Molecular Weight | 460.35 g/mol |
| Exact Mass | 459.01 |
| IUPAC Name | [4-bromo-2-[(4-methoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(/N=C/c2cc(Br)ccc2OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H18BrNO4S/c1-15-3-10-20(11-4-15)28(24,25)27-21-12-5-17(22)13-16(21)14-23-18-6-8-19(26-2)9-7-18/h3-14H,1-2H3/b23-14+ |
| InChIKey | PYQKXLOLHIULOB-OEAKJJBVSA-N |
| XLogP | 5.28 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.35 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|