C22H25BrN6O3S — CID 3415395
[2-[[[2,6-bis(dimethylamino)pyrimidin-4-yl]hydrazinylidene]methyl]-4-bromophenyl] 4-methylbenzenesulfonate (PubChem CID 3415395) has the molecular formula C22H25BrN6O3S and a molecular weight of 533.45 g/mol. Its IUPAC name is [2-[[[2,6-bis(dimethylamino)pyrimidin-4-yl]hydrazinylidene]methyl]-4-bromophenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-[[[2,6-bis(dimethylamino)pyrimidin-4-yl]hydrazinylidene]methyl]-4-bromophenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 3415395 |
| Molecular Formula | C22H25BrN6O3S |
| Molecular Weight | 533.45 g/mol |
| Exact Mass | 532.09 |
| IUPAC Name | [2-[[[2,6-bis(dimethylamino)pyrimidin-4-yl]hydrazinylidene]methyl]-4-bromophenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(Br)cc2C=NNc2cc(N(C)C)nc(N(C)C)n2)cc1 |
| InChI | InChI=1S/C22H25BrN6O3S/c1-15-6-9-18(10-7-15)33(30,31)32-19-11-8-17(23)12-16(19)14-24-27-20-13-21(28(2)3)26-22(25-20)29(4)5/h6-14H,1-5H3,(H,25,26,27) |
| InChIKey | QSTSIVMRVIBSNC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|