C29H23N3O3S2 — CID 124529730
[2-[(Z)-[(4,5-diphenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 124529730) has the molecular formula C29H23N3O3S2 and a molecular weight of 525.66 g/mol. Its IUPAC name is [2-[(Z)-[(4,5-diphenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-[(Z)-[(4,5-diphenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 124529730 |
| Molecular Formula | C29H23N3O3S2 |
| Molecular Weight | 525.66 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | [2-[(Z)-[(4,5-diphenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccccc2/C=N\Nc2nc(-c3ccccc3)c(-c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C29H23N3O3S2/c1-21-16-18-25(19-17-21)37(33,34)35-26-15-9-8-14-24(26)20-30-32-29-31-27(22-10-4-2-5-11-22)28(36-29)23-12-6-3-7-13-23/h2-20H,1H3,(H,31,32)/b30-20- |
| InChIKey | BMGOIIFSSVODHZ-COEJQBHMSA-N |
| XLogP | 7.00 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.66 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|