C21H16Br3NO2 — CID 126208407
1-[3,5-dibromo-2-[(4-bromophenyl)methoxy]phenyl]-N-(4-methoxyphenyl)methanimine (PubChem CID 126208407) has the molecular formula C21H16Br3NO2 and a molecular weight of 554.08 g/mol. Its IUPAC name is 1-[3,5-dibromo-2-[(4-bromophenyl)methoxy]phenyl]-N-(4-methoxyphenyl)methanimine.
| Compound Name | 1-[3,5-dibromo-2-[(4-bromophenyl)methoxy]phenyl]-N-(4-methoxyphenyl)methanimine |
|---|---|
| PubChem CID | 126208407 |
| Molecular Formula | C21H16Br3NO2 |
| Molecular Weight | 554.08 g/mol |
| Exact Mass | 550.87 |
| IUPAC Name | 1-[3,5-dibromo-2-[(4-bromophenyl)methoxy]phenyl]-N-(4-methoxyphenyl)methanimine |
| SMILES | COc1ccc(/N=C/c2cc(Br)cc(Br)c2OCc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C21H16Br3NO2/c1-26-19-8-6-18(7-9-19)25-12-15-10-17(23)11-20(24)21(15)27-13-14-2-4-16(22)5-3-14/h2-12H,13H2,1H3/b25-12+ |
| InChIKey | PUCTZJPLANUMIF-BRJLIKDPSA-N |
| XLogP | 7.31 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.08 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|