C22H18Br2ClNO — CID 126205449
1-[3,5-dibromo-2-[(4-chlorophenyl)methoxy]phenyl]-N-(4-ethylphenyl)methanimine (PubChem CID 126205449) has the molecular formula C22H18Br2ClNO and a molecular weight of 507.65 g/mol. Its IUPAC name is 1-[3,5-dibromo-2-[(4-chlorophenyl)methoxy]phenyl]-N-(4-ethylphenyl)methanimine.
| Compound Name | 1-[3,5-dibromo-2-[(4-chlorophenyl)methoxy]phenyl]-N-(4-ethylphenyl)methanimine |
|---|---|
| PubChem CID | 126205449 |
| Molecular Formula | C22H18Br2ClNO |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 504.94 |
| IUPAC Name | 1-[3,5-dibromo-2-[(4-chlorophenyl)methoxy]phenyl]-N-(4-ethylphenyl)methanimine |
| SMILES | CCc1ccc(/N=C/c2cc(Br)cc(Br)c2OCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H18Br2ClNO/c1-2-15-5-9-20(10-6-15)26-13-17-11-18(23)12-21(24)22(17)27-14-16-3-7-19(25)8-4-16/h3-13H,2,14H2,1H3/b26-13+ |
| InChIKey | ADJAXIWRUWWHCJ-LGJNPRDNSA-N |
| XLogP | 7.76 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|