C22H16Br2ClNO3 — CID 126222034
4-[[2,4-dibromo-6-[(5-chloro-2-methylphenyl)iminomethyl]phenoxy]methyl]benzoic acid (PubChem CID 126222034) has the molecular formula C22H16Br2ClNO3 and a molecular weight of 537.64 g/mol. Its IUPAC name is 4-[[2,4-dibromo-6-[(5-chloro-2-methylphenyl)iminomethyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2,4-dibromo-6-[(5-chloro-2-methylphenyl)iminomethyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126222034 |
| Molecular Formula | C22H16Br2ClNO3 |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 534.92 |
| IUPAC Name | 4-[[2,4-dibromo-6-[(5-chloro-2-methylphenyl)iminomethyl]phenoxy]methyl]benzoic acid |
| SMILES | Cc1ccc(Cl)cc1/N=C/c1cc(Br)cc(Br)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H16Br2ClNO3/c1-13-2-7-18(25)10-20(13)26-11-16-8-17(23)9-19(24)21(16)29-12-14-3-5-15(6-4-14)22(27)28/h2-11H,12H2,1H3,(H,27,28)/b26-11+ |
| InChIKey | FQCYIRCXGHYYSK-KBKYJPHKSA-N |
| XLogP | 7.20 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|