C23H20ClNO4 — CID 126193499
4-[[2-[(5-chloro-2-methylphenyl)iminomethyl]-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 126193499) has the molecular formula C23H20ClNO4 and a molecular weight of 409.87 g/mol. Its IUPAC name is 4-[[2-[(5-chloro-2-methylphenyl)iminomethyl]-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-[(5-chloro-2-methylphenyl)iminomethyl]-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126193499 |
| Molecular Formula | C23H20ClNO4 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 4-[[2-[(5-chloro-2-methylphenyl)iminomethyl]-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cccc(/C=N/c2cc(Cl)ccc2C)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H20ClNO4/c1-15-6-11-19(24)12-20(15)25-13-18-4-3-5-21(28-2)22(18)29-14-16-7-9-17(10-8-16)23(26)27/h3-13H,14H2,1-2H3,(H,26,27)/b25-13+ |
| InChIKey | OBPKQXXXKDDXSH-DHRITJCHSA-N |
| XLogP | 5.68 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|