C22H19NO3 — CID 23827129
4-[[2-[(2-methylphenyl)iminomethyl]phenoxy]methyl]benzoic acid (PubChem CID 23827129) has the molecular formula C22H19NO3 and a molecular weight of 345.40 g/mol. Its IUPAC name is 4-[[2-[(2-methylphenyl)iminomethyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-[(2-methylphenyl)iminomethyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 23827129 |
| Molecular Formula | C22H19NO3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 4-[[2-[(2-methylphenyl)iminomethyl]phenoxy]methyl]benzoic acid |
| SMILES | Cc1ccccc1/N=C/c1ccccc1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H19NO3/c1-16-6-2-4-8-20(16)23-14-19-7-3-5-9-21(19)26-15-17-10-12-18(13-11-17)22(24)25/h2-14H,15H2,1H3,(H,24,25)/b23-14+ |
| InChIKey | GVCFJWZZGQLLKT-OEAKJJBVSA-N |
| XLogP | 5.02 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|