C23H19NO6 — CID 126193715
4-[[2-[(4-carboxyphenyl)iminomethyl]-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 126193715) has the molecular formula C23H19NO6 and a molecular weight of 405.41 g/mol. Its IUPAC name is 4-[[2-[(4-carboxyphenyl)iminomethyl]-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-[(4-carboxyphenyl)iminomethyl]-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126193715 |
| Molecular Formula | C23H19NO6 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 4-[[2-[(4-carboxyphenyl)iminomethyl]-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cccc(/C=N/c2ccc(C(=O)O)cc2)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H19NO6/c1-29-20-4-2-3-18(13-24-19-11-9-17(10-12-19)23(27)28)21(20)30-14-15-5-7-16(8-6-15)22(25)26/h2-13H,14H2,1H3,(H,25,26)(H,27,28)/b24-13+ |
| InChIKey | QVVVDNNENRDUPG-ZMOGYAJESA-N |
| XLogP | 4.42 |
| TPSA | 105.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|