C22H18BrNO4 — CID 126192828
4-[[2-[(3-bromophenyl)iminomethyl]-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 126192828) has the molecular formula C22H18BrNO4 and a molecular weight of 440.29 g/mol. Its IUPAC name is 4-[[2-[(3-bromophenyl)iminomethyl]-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-[(3-bromophenyl)iminomethyl]-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126192828 |
| Molecular Formula | C22H18BrNO4 |
| Molecular Weight | 440.29 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | 4-[[2-[(3-bromophenyl)iminomethyl]-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cccc(/C=N/c2cccc(Br)c2)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H18BrNO4/c1-27-20-7-2-4-17(13-24-19-6-3-5-18(23)12-19)21(20)28-14-15-8-10-16(11-9-15)22(25)26/h2-13H,14H2,1H3,(H,25,26)/b24-13+ |
| InChIKey | DZCBEBSQQQBTDK-ZMOGYAJESA-N |
| XLogP | 5.49 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.29 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|