C28H26BrN3O5 — CID 126330911
4-[[2-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 126330911) has the molecular formula C28H26BrN3O5 and a molecular weight of 564.44 g/mol. Its IUPAC name is 4-[[2-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126330911 |
| Molecular Formula | C28H26BrN3O5 |
| Molecular Weight | 564.44 g/mol |
| Exact Mass | 563.11 |
| IUPAC Name | 4-[[2-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | CC[C@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cccc(OC)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C28H26BrN3O5/c1-4-17(2)26-31-23-13-12-21(29)14-22(23)27(33)32(26)30-15-20-6-5-7-24(36-3)25(20)37-16-18-8-10-19(11-9-18)28(34)35/h5-15,17H,4,16H2,1-3H3,(H,34,35)/t17-/m0/s1 |
| InChIKey | VJIHZFRAEDFGBL-KRWDZBQOSA-N |
| XLogP | 5.84 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.44 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|