C28H25BrClN3O5 — CID 126328509
3-[[2-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-4-chloro-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 126328509) has the molecular formula C28H25BrClN3O5 and a molecular weight of 598.88 g/mol. Its IUPAC name is 3-[[2-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-4-chloro-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-4-chloro-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126328509 |
| Molecular Formula | C28H25BrClN3O5 |
| Molecular Weight | 598.88 g/mol |
| Exact Mass | 597.07 |
| IUPAC Name | 3-[[2-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-4-chloro-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | CC[C@@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Cl)cc(OC)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C28H25BrClN3O5/c1-4-16(2)26-32-23-9-8-20(29)12-22(23)27(34)33(26)31-14-19-11-21(30)13-24(37-3)25(19)38-15-17-6-5-7-18(10-17)28(35)36/h5-14,16H,4,15H2,1-3H3,(H,35,36)/t16-/m1/s1 |
| InChIKey | JMRITZWAVAWVNV-MRXNPFEDSA-N |
| XLogP | 6.49 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.88 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|