C22H21BrClN3O5 — CID 126337735
2-[2-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-4-chloro-6-methoxyphenoxy]acetic acid (PubChem CID 126337735) has the molecular formula C22H21BrClN3O5 and a molecular weight of 522.78 g/mol. Its IUPAC name is 2-[2-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-4-chloro-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[2-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-4-chloro-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 126337735 |
| Molecular Formula | C22H21BrClN3O5 |
| Molecular Weight | 522.78 g/mol |
| Exact Mass | 521.04 |
| IUPAC Name | 2-[2-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-4-chloro-6-methoxyphenoxy]acetic acid |
| SMILES | CC[C@@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Cl)cc(OC)c1OCC(=O)O |
| InChI | InChI=1S/C22H21BrClN3O5/c1-4-12(2)21-26-17-6-5-14(23)8-16(17)22(30)27(21)25-10-13-7-15(24)9-18(31-3)20(13)32-11-19(28)29/h5-10,12H,4,11H2,1-3H3,(H,28,29)/t12-/m1/s1 |
| InChIKey | GOYWGEGJRSZEKR-GFCCVEGCSA-N |
| XLogP | 4.68 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.78 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|