C27H23BrClN3O5 — CID 126297354
3-[[2-[(6-bromo-4-oxo-2-propan-2-ylquinazolin-3-yl)iminomethyl]-4-chloro-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 126297354) has the molecular formula C27H23BrClN3O5 and a molecular weight of 584.85 g/mol. Its IUPAC name is 3-[[2-[(6-bromo-4-oxo-2-propan-2-ylquinazolin-3-yl)iminomethyl]-4-chloro-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-[(6-bromo-4-oxo-2-propan-2-ylquinazolin-3-yl)iminomethyl]-4-chloro-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126297354 |
| Molecular Formula | C27H23BrClN3O5 |
| Molecular Weight | 584.85 g/mol |
| Exact Mass | 583.05 |
| IUPAC Name | 3-[[2-[(6-bromo-4-oxo-2-propan-2-ylquinazolin-3-yl)iminomethyl]-4-chloro-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cc(Cl)cc(C=Nn2c(C(C)C)nc3ccc(Br)cc3c2=O)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C27H23BrClN3O5/c1-15(2)25-31-22-8-7-19(28)11-21(22)26(33)32(25)30-13-18-10-20(29)12-23(36-3)24(18)37-14-16-5-4-6-17(9-16)27(34)35/h4-13,15H,14H2,1-3H3,(H,34,35) |
| InChIKey | WSJIFFJKYKAEAF-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.85 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|