C29H27BrClN3O5 — CID 126309903
3-[[4-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-chloro-6-ethoxyphenoxy]methyl]benzoic acid (PubChem CID 126309903) has the molecular formula C29H27BrClN3O5 and a molecular weight of 612.91 g/mol. Its IUPAC name is 3-[[4-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-chloro-6-ethoxyphenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-chloro-6-ethoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126309903 |
| Molecular Formula | C29H27BrClN3O5 |
| Molecular Weight | 612.91 g/mol |
| Exact Mass | 611.08 |
| IUPAC Name | 3-[[4-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-chloro-6-ethoxyphenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(C=Nn2c([C@H](C)CC)nc3ccc(Br)cc3c2=O)cc(Cl)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C29H27BrClN3O5/c1-4-17(3)27-33-24-10-9-21(30)14-22(24)28(35)34(27)32-15-19-12-23(31)26(25(13-19)38-5-2)39-16-18-7-6-8-20(11-18)29(36)37/h6-15,17H,4-5,16H2,1-3H3,(H,36,37)/t17-/m1/s1 |
| InChIKey | OHPADGFFKIHKDK-QGZVFWFLSA-N |
| XLogP | 6.88 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.91 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|