C25H18O6 — CID 126192799
4-[[2-[(1,3-dioxoinden-2-ylidene)methyl]-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 126192799) has the molecular formula C25H18O6 and a molecular weight of 414.41 g/mol. Its IUPAC name is 4-[[2-[(1,3-dioxoinden-2-ylidene)methyl]-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-[(1,3-dioxoinden-2-ylidene)methyl]-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126192799 |
| Molecular Formula | C25H18O6 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 4-[[2-[(1,3-dioxoinden-2-ylidene)methyl]-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cccc(C=C2C(=O)c3ccccc3C2=O)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C25H18O6/c1-30-21-8-4-5-17(13-20-22(26)18-6-2-3-7-19(18)23(20)27)24(21)31-14-15-9-11-16(12-10-15)25(28)29/h2-13H,14H2,1H3,(H,28,29) |
| InChIKey | DPHOMVFQNYLIBF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|