C23H21Br2NO — CID 126207810
1-[3,5-dibromo-2-[(4-methylphenyl)methoxy]phenyl]-N-(3,4-dimethylphenyl)methanimine (PubChem CID 126207810) has the molecular formula C23H21Br2NO and a molecular weight of 487.24 g/mol. Its IUPAC name is 1-[3,5-dibromo-2-[(4-methylphenyl)methoxy]phenyl]-N-(3,4-dimethylphenyl)methanimine.
| Compound Name | 1-[3,5-dibromo-2-[(4-methylphenyl)methoxy]phenyl]-N-(3,4-dimethylphenyl)methanimine |
|---|---|
| PubChem CID | 126207810 |
| Molecular Formula | C23H21Br2NO |
| Molecular Weight | 487.24 g/mol |
| Exact Mass | 485.00 |
| IUPAC Name | 1-[3,5-dibromo-2-[(4-methylphenyl)methoxy]phenyl]-N-(3,4-dimethylphenyl)methanimine |
| SMILES | Cc1ccc(COc2c(Br)cc(Br)cc2/C=N/c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C23H21Br2NO/c1-15-4-7-18(8-5-15)14-27-23-19(11-20(24)12-22(23)25)13-26-21-9-6-16(2)17(3)10-21/h4-13H,14H2,1-3H3/b26-13+ |
| InChIKey | MUTPSTUPDAQPJU-LGJNPRDNSA-N |
| XLogP | 7.47 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.24 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|