C22H20BrNO — CID 126208760
1-(5-bromo-2-phenylmethoxyphenyl)-N-(3,4-dimethylphenyl)methanimine (PubChem CID 126208760) has the molecular formula C22H20BrNO and a molecular weight of 394.31 g/mol. Its IUPAC name is 1-(5-bromo-2-phenylmethoxyphenyl)-N-(3,4-dimethylphenyl)methanimine.
| Compound Name | 1-(5-bromo-2-phenylmethoxyphenyl)-N-(3,4-dimethylphenyl)methanimine |
|---|---|
| PubChem CID | 126208760 |
| Molecular Formula | C22H20BrNO |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 1-(5-bromo-2-phenylmethoxyphenyl)-N-(3,4-dimethylphenyl)methanimine |
| SMILES | Cc1ccc(/N=C/c2cc(Br)ccc2OCc2ccccc2)cc1C |
| InChI | InChI=1S/C22H20BrNO/c1-16-8-10-21(12-17(16)2)24-14-19-13-20(23)9-11-22(19)25-15-18-6-4-3-5-7-18/h3-14H,15H2,1-2H3/b24-14+ |
| InChIKey | RCNTXHXNJMYWCN-ZVHZXABRSA-N |
| XLogP | 6.40 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|