C22H18Br2ClNO2 — CID 126220707
1-[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]-N-(5-chloro-2-methylphenyl)methanimine (PubChem CID 126220707) has the molecular formula C22H18Br2ClNO2 and a molecular weight of 523.65 g/mol. Its IUPAC name is 1-[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]-N-(5-chloro-2-methylphenyl)methanimine.
| Compound Name | 1-[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]-N-(5-chloro-2-methylphenyl)methanimine |
|---|---|
| PubChem CID | 126220707 |
| Molecular Formula | C22H18Br2ClNO2 |
| Molecular Weight | 523.65 g/mol |
| Exact Mass | 520.94 |
| IUPAC Name | 1-[3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxyphenyl]-N-(5-chloro-2-methylphenyl)methanimine |
| SMILES | COc1cc(/C=N/c2cc(Cl)ccc2C)cc(Br)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H18Br2ClNO2/c1-14-3-8-18(25)11-20(14)26-12-16-9-19(24)22(21(10-16)27-2)28-13-15-4-6-17(23)7-5-15/h3-12H,13H2,1-2H3/b26-12+ |
| InChIKey | VMWSYARACCLJHL-RPPGKUMJSA-N |
| XLogP | 7.51 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.65 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|