C22H20BrNO2 — CID 126224885
1-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-N-(2-methylphenyl)methanimine (PubChem CID 126224885) has the molecular formula C22H20BrNO2 and a molecular weight of 410.31 g/mol. Its IUPAC name is 1-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-N-(2-methylphenyl)methanimine.
| Compound Name | 1-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-N-(2-methylphenyl)methanimine |
|---|---|
| PubChem CID | 126224885 |
| Molecular Formula | C22H20BrNO2 |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 1-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-N-(2-methylphenyl)methanimine |
| SMILES | COc1cc(/C=N/c2ccccc2C)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C22H20BrNO2/c1-16-8-6-7-11-20(16)24-14-18-12-19(23)22(21(13-18)25-2)26-15-17-9-4-3-5-10-17/h3-14H,15H2,1-2H3/b24-14+ |
| InChIKey | XKPPDFSYURZUMG-ZVHZXABRSA-N |
| XLogP | 6.10 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|