C20H13Br2ClN2O3 — CID 126052498
1-[3,5-dibromo-2-[(3-chlorophenyl)methoxy]phenyl]-N-(4-nitrophenyl)methanimine (PubChem CID 126052498) has the molecular formula C20H13Br2ClN2O3 and a molecular weight of 524.60 g/mol. Its IUPAC name is 1-[3,5-dibromo-2-[(3-chlorophenyl)methoxy]phenyl]-N-(4-nitrophenyl)methanimine.
| Compound Name | 1-[3,5-dibromo-2-[(3-chlorophenyl)methoxy]phenyl]-N-(4-nitrophenyl)methanimine |
|---|---|
| PubChem CID | 126052498 |
| Molecular Formula | C20H13Br2ClN2O3 |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 521.90 |
| IUPAC Name | 1-[3,5-dibromo-2-[(3-chlorophenyl)methoxy]phenyl]-N-(4-nitrophenyl)methanimine |
| SMILES | O=[N+]([O-])c1ccc(/N=C/c2cc(Br)cc(Br)c2OCc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C20H13Br2ClN2O3/c21-15-9-14(11-24-17-4-6-18(7-5-17)25(26)27)20(19(22)10-15)28-12-13-2-1-3-16(23)8-13/h1-11H,12H2/b24-11+ |
| InChIKey | IHXSVUZPRBMHEN-BHGWPJFGSA-N |
| XLogP | 7.10 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|