C26H16Br4N2O4S — CID 4655751
2,4-dibromo-6-[[4-[4-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]phenyl]sulfonylphenyl]iminomethyl]phenol (PubChem CID 4655751) has the molecular formula C26H16Br4N2O4S and a molecular weight of 772.11 g/mol. Its IUPAC name is 2,4-dibromo-6-[[4-[4-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]phenyl]sulfonylphenyl]iminomethyl]phenol.
| Compound Name | 2,4-dibromo-6-[[4-[4-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]phenyl]sulfonylphenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 4655751 |
| Molecular Formula | C26H16Br4N2O4S |
| Molecular Weight | 772.11 g/mol |
| Exact Mass | 767.76 |
| IUPAC Name | 2,4-dibromo-6-[[4-[4-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]phenyl]sulfonylphenyl]iminomethyl]phenol |
| SMILES | O=S(=O)(c1ccc(/N=C/c2cc(Br)cc(Br)c2O)cc1)c1ccc(/N=C/c2cc(Br)cc(Br)c2O)cc1 |
| InChI | InChI=1S/C26H16Br4N2O4S/c27-17-9-15(25(33)23(29)11-17)13-31-19-1-5-21(6-2-19)37(35,36)22-7-3-20(4-8-22)32-14-16-10-18(28)12-24(30)26(16)34/h1-14,33-34H/b31-13+,32-14+ |
| InChIKey | DJCGFQFHIKUUMO-GCFMLEDASA-N |
| XLogP | 8.48 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.11 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|