C14H13Br2N3O3S — CID 142691931
N-(aminomethyl)-4-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]benzenesulfonamide (PubChem CID 142691931) has the molecular formula C14H13Br2N3O3S and a molecular weight of 463.15 g/mol. Its IUPAC name is N-(aminomethyl)-4-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]benzenesulfonamide.
| Compound Name | N-(aminomethyl)-4-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 142691931 |
| Molecular Formula | C14H13Br2N3O3S |
| Molecular Weight | 463.15 g/mol |
| Exact Mass | 460.90 |
| IUPAC Name | N-(aminomethyl)-4-[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]benzenesulfonamide |
| SMILES | NCNS(=O)(=O)c1ccc(/N=C/c2cc(Br)cc(Br)c2O)cc1 |
| InChI | InChI=1S/C14H13Br2N3O3S/c15-10-5-9(14(20)13(16)6-10)7-18-11-1-3-12(4-2-11)23(21,22)19-8-17/h1-7,19-20H,8,17H2/b18-7+ |
| InChIKey | VRINOUGGBRZPCO-CNHKJKLMSA-N |
| XLogP | 2.86 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.15 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|