C17H14BrN5O6S2 — CID 4567412
4-[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-N-(5-ethoxy-1,3,4-thiadiazol-2-yl)benzenesulfonamide (PubChem CID 4567412) has the molecular formula C17H14BrN5O6S2 and a molecular weight of 528.37 g/mol. Its IUPAC name is 4-[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-N-(5-ethoxy-1,3,4-thiadiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-N-(5-ethoxy-1,3,4-thiadiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 4567412 |
| Molecular Formula | C17H14BrN5O6S2 |
| Molecular Weight | 528.37 g/mol |
| Exact Mass | 526.96 |
| IUPAC Name | 4-[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-N-(5-ethoxy-1,3,4-thiadiazol-2-yl)benzenesulfonamide |
| SMILES | CCOc1nnc(NS(=O)(=O)c2ccc(/N=C/c3cc(Br)cc([N+](=O)[O-])c3O)cc2)s1 |
| InChI | InChI=1S/C17H14BrN5O6S2/c1-2-29-17-21-20-16(30-17)22-31(27,28)13-5-3-12(4-6-13)19-9-10-7-11(18)8-14(15(10)24)23(25)26/h3-9,24H,2H2,1H3,(H,20,22)/b19-9+ |
| InChIKey | OKAPMXRVHWLWJP-DJKKODMXSA-N |
| XLogP | 3.86 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|