C11H10N4O6S2 — CID 71852333
ethyl 5-[(4-nitrophenyl)sulfonylamino]-1,3,4-thiadiazole-2-carboxylate (PubChem CID 71852333) has the molecular formula C11H10N4O6S2 and a molecular weight of 358.36 g/mol. Its IUPAC name is ethyl 5-[(4-nitrophenyl)sulfonylamino]-1,3,4-thiadiazole-2-carboxylate.
| Compound Name | ethyl 5-[(4-nitrophenyl)sulfonylamino]-1,3,4-thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 71852333 |
| Molecular Formula | C11H10N4O6S2 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | ethyl 5-[(4-nitrophenyl)sulfonylamino]-1,3,4-thiadiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nnc(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C11H10N4O6S2/c1-2-21-10(16)9-12-13-11(22-9)14-23(19,20)8-5-3-7(4-6-8)15(17)18/h3-6H,2H2,1H3,(H,13,14) |
| InChIKey | WMEUGBDVGJUNSW-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 141.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|