C13H10BrNO4S — CID 4779411
4-[(5-bromo-2-hydroxyphenyl)methylideneamino]benzenesulfonic acid (PubChem CID 4779411) has the molecular formula C13H10BrNO4S and a molecular weight of 356.20 g/mol. Its IUPAC name is 4-[(5-bromo-2-hydroxyphenyl)methylideneamino]benzenesulfonic acid.
| Compound Name | 4-[(5-bromo-2-hydroxyphenyl)methylideneamino]benzenesulfonic acid |
|---|---|
| PubChem CID | 4779411 |
| Molecular Formula | C13H10BrNO4S |
| Molecular Weight | 356.20 g/mol |
| Exact Mass | 354.95 |
| IUPAC Name | 4-[(5-bromo-2-hydroxyphenyl)methylideneamino]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(/N=C/c2cc(Br)ccc2O)cc1 |
| InChI | InChI=1S/C13H10BrNO4S/c14-10-1-6-13(16)9(7-10)8-15-11-2-4-12(5-3-11)20(17,18)19/h1-8,16H,(H,17,18,19)/b15-8+ |
| InChIKey | ZIYWSQXSLBQDPS-OVCLIPMQSA-N |
| XLogP | 3.15 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.20 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|