About cobalt(2+);bis(2-[(4-sulfophenyl)iminomethyl]phenolate)
cobalt(2+);bis(2-[(4-sulfophenyl)iminomethyl]phenolate) (PubChem CID 6711571) has the molecular formula C26H20CoN2O8S2
and a molecular weight of 611.52 g/mol. Its IUPAC name is cobalt(2+);bis(2-[(4-sulfophenyl)iminomethyl]phenolate).
Molecular Properties
| Compound Name | cobalt(2+);bis(2-[(4-sulfophenyl)iminomethyl]phenolate) |
| PubChem CID | 6711571 |
| Molecular Formula | C26H20CoN2O8S2 |
| Molecular Weight | 611.52 g/mol |
| Exact Mass | 611.00 |
| IUPAC Name | cobalt(2+);bis(2-[(4-sulfophenyl)iminomethyl]phenolate) |
| SMILES | O=S(=O)(O)c1ccc(/N=C/c2ccccc2[O-])cc1.O=S(=O)(O)c1ccc(/N=C/c2ccccc2[O-])cc1.[Co+2] |
| InChI | InChI=1S/2C13H11NO4S.Co/c2*15-13-4-2-1-3-10(13)9-14-11-5-7-12(8-6-11)19(16,17)18;/h2*1-9,15H,(H,16,17,18);/q;;+2/p-2/b2*14-9+; |
| InChIKey | MDTMPTHMAQZIGR-ZNVPEIAMSA-L |
| XLogP | 3.51 |
| TPSA | 179.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 611.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze cobalt(2+);bis(2-[(4-sulfophenyl)iminomethyl]phenolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(2+);bis(2-[(4-sulfophenyl)iminomethyl]phenolate)?
The IUPAC name of cobalt(2+);bis(2-[(4-sulfophenyl)iminomethyl]phenolate) (CID 6711571) is cobalt(2+);bis(2-[(4-sulfophenyl)iminomethyl]phenolate).
What is the SMILES notation for cobalt(2+);bis(2-[(4-sulfophenyl)iminomethyl]phenolate)?
The canonical SMILES for cobalt(2+);bis(2-[(4-sulfophenyl)iminomethyl]phenolate) is O=S(=O)(O)c1ccc(/N=C/c2ccccc2[O-])cc1.O=S(=O)(O)c1ccc(/N=C/c2ccccc2[O-])cc1.[Co+2].
What is the InChIKey of cobalt(2+);bis(2-[(4-sulfophenyl)iminomethyl]phenolate)?
The InChIKey is MDTMPTHMAQZIGR-ZNVPEIAMSA-L. The full InChI is InChI=1S/2C13H11NO4S.Co/c2*15-13-4-2-1-3-10(13)9-14-11-5-7-12(8-6-11)19(16,17)18;/h2*1-9,15H,(H,16,17,18);/q;;+2/p-2/b2*14-9+;.
What are the key properties of cobalt(2+);bis(2-[(4-sulfophenyl)iminomethyl]phenolate)?
cobalt(2+);bis(2-[(4-sulfophenyl)iminomethyl]phenolate) has a molecular weight of 611.52 g/mol, XLogP of 3.51, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(2+);bis(2-[(4-sulfophenyl)iminomethyl]phenolate) is sourced from PubChem (CID 6711571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).