C26H20CoN2O8S2 — CID 6711571
cobalt(2+);bis(2-[(4-sulfophenyl)iminomethyl]phenolate) (PubChem CID 6711571) has the molecular formula C26H20CoN2O8S2 and a molecular weight of 611.52 g/mol. Its IUPAC name is cobalt(2+);bis(2-[(4-sulfophenyl)iminomethyl]phenolate).
| Compound Name | cobalt(2+);bis(2-[(4-sulfophenyl)iminomethyl]phenolate) |
|---|---|
| PubChem CID | 6711571 |
| Molecular Formula | C26H20CoN2O8S2 |
| Molecular Weight | 611.52 g/mol |
| Exact Mass | 611.00 |
| IUPAC Name | cobalt(2+);bis(2-[(4-sulfophenyl)iminomethyl]phenolate) |
| SMILES | O=S(=O)(O)c1ccc(/N=C/c2ccccc2[O-])cc1.O=S(=O)(O)c1ccc(/N=C/c2ccccc2[O-])cc1.[Co+2] |
| InChI | InChI=1S/2C13H11NO4S.Co/c2*15-13-4-2-1-3-10(13)9-14-11-5-7-12(8-6-11)19(16,17)18;/h2*1-9,15H,(H,16,17,18);/q;;+2/p-2/b2*14-9+; |
| InChIKey | MDTMPTHMAQZIGR-ZNVPEIAMSA-L |
| XLogP | 3.51 |
| TPSA | 179.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|