C20H14N2NiO2-2 — CID 58725494
nickel;2-[[2-[(2-oxidophenyl)methylideneamino]phenyl]iminomethyl]phenolate (PubChem CID 58725494) has the molecular formula C20H14N2NiO2-2 and a molecular weight of 373.04 g/mol. Its IUPAC name is nickel;2-[[2-[(2-oxidophenyl)methylideneamino]phenyl]iminomethyl]phenolate.
| Compound Name | nickel;2-[[2-[(2-oxidophenyl)methylideneamino]phenyl]iminomethyl]phenolate |
|---|---|
| PubChem CID | 58725494 |
| Molecular Formula | C20H14N2NiO2-2 |
| Molecular Weight | 373.04 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | nickel;2-[[2-[(2-oxidophenyl)methylideneamino]phenyl]iminomethyl]phenolate |
| SMILES | [Ni].[O-]c1ccccc1/C=N/c1ccccc1/N=C/c1ccccc1[O-] |
| InChI | InChI=1S/C20H16N2O2.Ni/c23-19-11-5-1-7-15(19)13-21-17-9-3-4-10-18(17)22-14-16-8-2-6-12-20(16)24;/h1-14,23-24H;/p-2/b21-13+,22-14+; |
| InChIKey | NGCXCGQPUMDVAF-JKBLJYNNSA-L |
| XLogP | 3.33 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.04 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|