About copper bis(2-[(4-phenyldiazenylphenyl)iminomethyl]phenolate)
copper bis(2-[(4-phenyldiazenylphenyl)iminomethyl]phenolate) (PubChem CID 139172748) has the molecular formula C38H28CuN6O2
and a molecular weight of 664.23 g/mol. Its IUPAC name is copper bis(2-[(4-phenyldiazenylphenyl)iminomethyl]phenolate).
Molecular Properties
| Compound Name | copper bis(2-[(4-phenyldiazenylphenyl)iminomethyl]phenolate) |
| PubChem CID | 139172748 |
| Molecular Formula | C38H28CuN6O2 |
| Molecular Weight | 664.23 g/mol |
| Exact Mass | 663.16 |
| IUPAC Name | copper bis(2-[(4-phenyldiazenylphenyl)iminomethyl]phenolate) |
| SMILES | [Cu+2].[O-]c1ccccc1/C=N/c1ccc(/N=N/c2ccccc2)cc1.[O-]c1ccccc1/C=N/c1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/2C19H15N3O.Cu/c2*23-19-9-5-4-6-15(19)14-20-16-10-12-18(13-11-16)22-21-17-7-2-1-3-8-17;/h2*1-14,23H;/q;;+2/p-2/b2*20-14+,22-21+; |
| InChIKey | PKNQIOGAARMWND-PPAOKHEJSA-L |
| XLogP | 9.85 |
| TPSA | 120.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 664.23 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze copper bis(2-[(4-phenyldiazenylphenyl)iminomethyl]phenolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper bis(2-[(4-phenyldiazenylphenyl)iminomethyl]phenolate)?
The IUPAC name of copper bis(2-[(4-phenyldiazenylphenyl)iminomethyl]phenolate) (CID 139172748) is copper bis(2-[(4-phenyldiazenylphenyl)iminomethyl]phenolate).
What is the SMILES notation for copper bis(2-[(4-phenyldiazenylphenyl)iminomethyl]phenolate)?
The canonical SMILES for copper bis(2-[(4-phenyldiazenylphenyl)iminomethyl]phenolate) is [Cu+2].[O-]c1ccccc1/C=N/c1ccc(/N=N/c2ccccc2)cc1.[O-]c1ccccc1/C=N/c1ccc(/N=N/c2ccccc2)cc1.
What is the InChIKey of copper bis(2-[(4-phenyldiazenylphenyl)iminomethyl]phenolate)?
The InChIKey is PKNQIOGAARMWND-PPAOKHEJSA-L. The full InChI is InChI=1S/2C19H15N3O.Cu/c2*23-19-9-5-4-6-15(19)14-20-16-10-12-18(13-11-16)22-21-17-7-2-1-3-8-17;/h2*1-14,23H;/q;;+2/p-2/b2*20-14+,22-21+;.
What are the key properties of copper bis(2-[(4-phenyldiazenylphenyl)iminomethyl]phenolate)?
copper bis(2-[(4-phenyldiazenylphenyl)iminomethyl]phenolate) has a molecular weight of 664.23 g/mol, XLogP of 9.85, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for copper bis(2-[(4-phenyldiazenylphenyl)iminomethyl]phenolate) is sourced from PubChem (CID 139172748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).