C19H13I2N3O — CID 5076612
2,4-diiodo-6-[(4-phenyldiazenylphenyl)iminomethyl]phenol (PubChem CID 5076612) has the molecular formula C19H13I2N3O and a molecular weight of 553.14 g/mol. Its IUPAC name is 2,4-diiodo-6-[(4-phenyldiazenylphenyl)iminomethyl]phenol.
| Compound Name | 2,4-diiodo-6-[(4-phenyldiazenylphenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 5076612 |
| Molecular Formula | C19H13I2N3O |
| Molecular Weight | 553.14 g/mol |
| Exact Mass | 552.91 |
| IUPAC Name | 2,4-diiodo-6-[(4-phenyldiazenylphenyl)iminomethyl]phenol |
| SMILES | Oc1c(I)cc(I)cc1/C=N/c1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C19H13I2N3O/c20-14-10-13(19(25)18(21)11-14)12-22-15-6-8-17(9-7-15)24-23-16-4-2-1-3-5-16/h1-12,25H/b22-12+,24-23+ |
| InChIKey | MZFPNDNMBIZJRJ-OBMCKAMCSA-N |
| XLogP | 6.77 |
| TPSA | 57.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.14 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|