C19H15N3O3 — CID 136719331
4-[(4-phenyldiazenylphenyl)iminomethyl]benzene-1,2,3-triol (PubChem CID 136719331) has the molecular formula C19H15N3O3 and a molecular weight of 333.35 g/mol. Its IUPAC name is 4-[(4-phenyldiazenylphenyl)iminomethyl]benzene-1,2,3-triol.
| Compound Name | 4-[(4-phenyldiazenylphenyl)iminomethyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 136719331 |
| Molecular Formula | C19H15N3O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 4-[(4-phenyldiazenylphenyl)iminomethyl]benzene-1,2,3-triol |
| SMILES | Oc1ccc(/C=N/c2ccc(/N=N/c3ccccc3)cc2)c(O)c1O |
| InChI | InChI=1S/C19H15N3O3/c23-17-11-6-13(18(24)19(17)25)12-20-14-7-9-16(10-8-14)22-21-15-4-2-1-3-5-15/h1-12,23-25H/b20-12+,22-21+ |
| InChIKey | ORNIASCQQSFKDS-DERSFYRZSA-N |
| XLogP | 4.97 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|